CAS 1072945-56-2
:Benzenamine, 3,4-difluoro-2-methoxy-, sulfate (1:1)
Description:
Benzenamine, 3,4-difluoro-2-methoxy-, sulfate (1:1), with the CAS number 1072945-56-2, is an organic compound characterized by its aromatic amine structure, which includes a benzene ring substituted with two fluorine atoms and a methoxy group. The presence of the sulfate moiety indicates that this compound is a salt or ester derived from sulfuric acid, contributing to its solubility and reactivity in various chemical environments. The difluoromethoxy substitution pattern can influence the compound's electronic properties, potentially affecting its reactivity and interactions with biological systems. This compound may exhibit unique characteristics such as altered polarity and hydrogen bonding capabilities due to the presence of both fluorine and methoxy groups. Its applications could span across pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and behavior in different chemical contexts. Safety and handling precautions should be observed, as with all chemical substances, particularly those involving amines and fluorinated compounds.
Formula:C7H7F2NO·H2O4S
InChI:InChI=1S/C7H7F2NO.H2O4S/c1-11-7-5(10)3-2-4(8)6(7)9;1-5(2,3)4/h2-3H,10H2,1H3;(H2,1,2,3,4)
InChI key:InChIKey=PQVPJVCSMVAHPE-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)C(F)=CC=C1N.S(=O)(=O)(O)O
Synonyms:- Benzenamine, 3,4-difluoro-2-methoxy-, sulfate (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
