CAS 1072945-76-6
:(2R)-3-[[(2-Aminoethoxy)hydroxyphosphinyl]oxy]-2-hydroxypropyl (4Z,7Z,10Z,13Z,16Z,19Z)-4,7,10,13,16,19-docosahexaenoate
Description:
The chemical substance known as "(2R)-3-[[(2-Aminoethoxy)hydroxyphosphinyl]oxy]-2-hydroxypropyl (4Z,7Z,10Z,13Z,16Z,19Z)-4,7,10,13,16,19-docosahexaenoate" with CAS number 1072945-76-6 is a complex organic compound characterized by its unique structural features. It contains a phosphinyl group, which is indicative of its potential biological activity, particularly in the context of phosphonate chemistry. The presence of multiple double bonds in the docosahexaenoate moiety suggests that it may exhibit significant reactivity and could play a role in various biochemical processes. Additionally, the aminoethoxy and hydroxy groups contribute to its hydrophilicity, potentially influencing its solubility and interaction with biological membranes. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific pathways or conditions. Its stereochemistry, denoted by the (2R) configuration, implies specific spatial arrangements that can affect its biological function and interactions. Overall, this substance represents a fascinating area of study within medicinal and organic chemistry.
Formula:C27H44NO7P
InChI:InChI=1S/C27H44NO7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-27(30)33-24-26(29)25-35-36(31,32)34-23-22-28/h3-4,6-7,9-10,12-13,15-16,18-19,26,29H,2,5,8,11,14,17,20-25,28H2,1H3,(H,31,32)/b4-3-,7-6-,10-9-,13-12-,16-15-,19-18-/t26-/m1/s1
InChI key:InChIKey=XEVRBOQZSXWGQO-PAUXXPOVSA-N
SMILES:P(OC[C@@H](COC(CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CC)=O)O)(OCCN)(=O)O
Synonyms:- 4,7,10,13,16,19-Docosahexaenoic acid, (2R)-3-[[(2-aminoethoxy)hydroxyphosphinyl]oxy]-2-hydroxypropyl ester, (4Z,7Z,10Z,13Z,16Z,19Z)-
- (2R)-3-[[(2-Aminoethoxy)hydroxyphosphinyl]oxy]-2-hydroxypropyl (4Z,7Z,10Z,13Z,16Z,19Z)-4,7,10,13,16,19-docosahexaenoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

