CymitQuimica logo

CAS 1072945-78-8

:

B-(4-Butyl-5-pyrimidinyl)boronic acid

Description:
B-(4-Butyl-5-pyrimidinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyrimidine ring with a butyl substituent. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The pyrimidine moiety contributes to its potential biological activity, as pyrimidine derivatives are often found in pharmaceuticals. The butyl group enhances the lipophilicity of the molecule, which can influence its solubility and permeability in biological systems. Additionally, boronic acids are known for their role in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Overall, B-(4-Butyl-5-pyrimidinyl)boronic acid is a versatile compound with potential applications in drug development and materials science, owing to its unique structural features and reactivity.
Formula:C8H13BN2O2
InChI:InChI=1S/C8H13BN2O2/c1-2-3-4-8-7(9(12)13)5-10-6-11-8/h5-6,12-13H,2-4H2,1H3
InChI key:InChIKey=IJENVCJCQXKSEF-UHFFFAOYSA-N
SMILES:C(CCC)C=1C(B(O)O)=CN=CN1
Synonyms:
  • Boronic acid, B-(4-butyl-5-pyrimidinyl)-
  • B-(4-Butyl-5-pyrimidinyl)boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.