CAS 1072945-91-5

B-[1-(2-Chlorophenyl)-1H-pyrazol-4-yl]boronic acid

Description:

B-[1-(2-Chlorophenyl)-1H-pyrazol-4-yl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group and a pyrazole ring substituted with a chlorophenyl group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the chlorophenyl moiety can influence its reactivity and solubility, potentially enhancing its biological activity. Boronic acids are known for their role in Suzuki coupling reactions, which are pivotal in the formation of carbon-carbon bonds in organic synthesis. Additionally, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its structural features suggest potential applications in the development of targeted therapies, particularly in oncology, where boronic acids have been explored for their ability to inhibit specific enzymes. Overall, B-[1-(2-Chlorophenyl)-1H-pyrazol-4-yl]boronic acid represents a versatile building block in both synthetic and medicinal chemistry.

Formula: C₉H₈BClN₂O₂

InChI: InChI=1S/C9H8BClN2O2/c11-8-3-1-2-4-9(8)13-6-7(5-12-13)10(14)15/h1-6,14-15H

InChI key: InChIKey=MVLVNKOFJKGBIG-UHFFFAOYSA-N

SMILES: ClC1=C(C=CC=C1)N2C=C(B(O)O)C=N2

1-(2-Chlorophenyl)pyrazole-4-boronic acid

CAS: 1072945-91-5

Formula: C₉H₈BClN₂O₂

Molecular weight: 222.4360

Ref: IN-DA003CU3

1-(2-Chlorophenyl)pyrazole-4-boronic acid

CAS: 1072945-91-5

1-(2-Chlorophenyl)pyrazole-4-boronic acid

Purity: ≥95%

Molecular weight: 222.44g/mol

Ref: 54-OR360986