![B-[3-(2-Nitrophenoxy)phenyl]boronic acid](https://static.cymitquimica.com/cas-image/17390-b-3-2-nitrophenoxy-phenyl-boronic-acid.png)
CAS 1072945-95-9: B-[3-(2-Nitrophenoxy)phenyl]boronic acid
Description:B-[3-(2-Nitrophenoxy)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which typically exhibits properties such as Lewis acidity and the ability to form reversible covalent bonds with diols. This compound features a phenyl ring substituted with a nitrophenoxy group, which can influence its reactivity and solubility. The nitro group is known for its electron-withdrawing properties, potentially enhancing the acidity of the boronic acid moiety. Boronic acids are widely utilized in organic synthesis, particularly in Suzuki coupling reactions, which are essential for forming carbon-carbon bonds. Additionally, the presence of the nitrophenoxy group may impart specific electronic properties, making this compound of interest in medicinal chemistry and materials science. Its solubility in organic solvents and water can vary, depending on the substituents and the overall molecular structure. Overall, B-[3-(2-Nitrophenoxy)phenyl]boronic acid serves as a valuable building block in various chemical applications, particularly in the development of pharmaceuticals and advanced materials.
Formula:C12H10BNO5
InChI:InChI=1S/C12H10BNO5/c15-13(16)9-4-3-5-10(8-9)19-12-7-2-1-6-11(12)14(17)18/h1-8,15-16H
InChI key:InChIKey=VXKDGJZAMJMTPY-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C=CC=CC1OC2=CC=CC(=C2)B(O)O
- Synonyms:
- Boronic acid, B-[3-(2-nitrophenoxy)phenyl]-
- B-[3-(2-Nitrophenoxy)phenyl]boronic acid
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 3-(2-Nitrophenoxy)phenylboronic acid REF: IN-DA007ESBCAS: 1072945-95-9 | - - - | To inquire | Mon 03 Mar 25 |
 | 3-(2-Nitrophenoxy)phenylboronic acid REF: 54-OR360342CAS: 1072945-95-9 | - - - | To inquire | Tue 04 Mar 25 |
 | (3-(2-Nitrophenoxy)phenyl)boronic acid REF: 10-F212256CAS: 1072945-95-9 | 95.0% | - - - | Discontinued product |
 | 3-(2-Nitrophenoxy)phenylboronic acid REF: 3D-XSB94595CAS: 1072945-95-9 | Min. 95% | - - - | Discontinued product |
Ref: 54-OR360342
| Undefined size | To inquire |
(3-(2-Nitrophenoxy)phenyl)boronic acid
Ref: 10-F212256
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information |
3-(2-Nitrophenoxy)phenylboronic acid
Ref: 3D-XSB94595
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information | |
| 10g | Discontinued | Request information | |
| 25g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
