CAS 1072946-20-3

B-(6-Chloro-4-methoxy-3-pyridinyl)boronic acid

Description:

B-(6-Chloro-4-methoxy-3-pyridinyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a pyridine ring. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and methanol, and possessing a moderate melting point. The presence of the chloro and methoxy substituents on the pyridine ring enhances its reactivity and potential applications in organic synthesis, particularly in cross-coupling reactions like Suzuki-Miyaura coupling, which is valuable in the formation of carbon-carbon bonds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various biochemical applications. The compound's structure suggests potential biological activity, which may be explored in medicinal chemistry. Overall, B-(6-Chloro-4-methoxy-3-pyridinyl)boronic acid is a versatile building block in both synthetic and medicinal chemistry.

Formula: C₆H₇BClNO₃

InChI: InChI=1S/C6H7BClNO3/c1-12-5-2-6(8)9-3-4(5)7(10)11/h2-3,10-11H,1H3

InChI key: InChIKey=XZYKMRJYFUEGON-UHFFFAOYSA-N

SMILES: O(C)C=1C(B(O)O)=CN=C(Cl)C1

Synonyms:

• B-(6-Chloro-4-methoxy-3-pyridinyl)boronic acid
• Boronic acid, B-(6-chloro-4-methoxy-3-pyridinyl)-
• (6-Chloro-4-methoxypyridin-3-yl)boronic acid
• 2-Chloro-4-methoxypyridine-5-boronic acid

2-Chloro-4-methoxypyridine-5-boronic acid

CAS: 1072946-20-3

Formula: C₆H₇BClNO₃

Purity: 95%

Molecular weight: 187.3887

Ref: IN-DA007ES7

2-Chloro-4-methoxypyridine-5-boronic acid

CAS: 1072946-20-3

2-Chloro-4-methoxypyridine-5-boronic acid

Purity: ≥95%

Molecular weight: 187.39g/mol

Ref: 54-OR360955

(6-Chloro-4-methoxypyridin-3-yl)boronic acid

CAS: 1072946-20-3

Formula: C₆H₇BClNO₃

Purity: 95.0%

Molecular weight: 187.39

Ref: 10-F228419