CymitQuimica logo

CAS 1072946-37-2

:

(2,6-Dichloro-3-nitrophenyl)boronicacid

Description:
(2,6-Dichloro-3-nitrophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two chlorine atoms and one nitro group. This compound typically exhibits a crystalline solid form and is soluble in polar organic solvents. The presence of the boronic acid group allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, which are valuable in organic synthesis for forming carbon-carbon bonds. The chlorine and nitro substituents can influence the electronic properties of the molecule, potentially enhancing its reactivity and making it useful in medicinal chemistry and materials science. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in drug development. Safety and handling precautions should be observed due to the potential toxicity associated with halogenated compounds and nitro groups. Overall, (2,6-Dichloro-3-nitrophenyl)boronic acid is a versatile compound with applications in synthetic organic chemistry and pharmaceuticals.
Formula:C6H4BCl2NO4
InChI:InChI=1S/C6H4BCl2NO4/c8-3-1-2-4(10(13)14)6(9)5(3)7(11)12/h1-2,11-12H
InChI key:ZLBSACXTTUJLJN-UHFFFAOYSA-N
SMILES:c1cc(c(c(c1Cl)B(O)O)Cl)N(=O)=O
Found 4 products.