![B-[4-(1,3-Dioxolan-2-yl)-2,6-difluorophenyl]boronic acid](https://static.cymitquimica.com/cas-image/217507-b-4-13-dioxolan-2-yl-26-difluorophenyl-boronic-acid.png)
CAS 1072946-41-8: B-[4-(1,3-Dioxolan-2-yl)-2,6-difluorophenyl]boronic acid
Description:B-[4-(1,3-Dioxolan-2-yl)-2,6-difluorophenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a difluorophenyl moiety, enhancing its electronic properties and potentially influencing its reactivity and solubility. The 1,3-dioxolane ring contributes to its structural complexity, providing a stable cyclic ether that can participate in various chemical reactions. Typically, boronic acids are utilized in Suzuki coupling reactions, making this compound valuable in organic synthesis, particularly in the formation of carbon-carbon bonds. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. The presence of fluorine atoms can enhance lipophilicity and metabolic stability, which are critical factors in drug design. Overall, this compound's characteristics make it a versatile building block in both synthetic and pharmaceutical chemistry.
Formula:C9H9BF2O4
InChI:InChI=1S/C9H9BF2O4/c11-6-3-5(9-15-1-2-16-9)4-7(12)8(6)10(13)14/h3-4,9,13-14H,1-2H2
InChI key:InChIKey=GTBJZTQCEQYQLQ-UHFFFAOYSA-N
SMILES:FC=1C=C(C=C(F)C1B(O)O)C2OCCO2
- Synonyms:
- B-[4-(1,3-Dioxolan-2-yl)-2,6-difluorophenyl]boronic acid
- Boronic acid, B-[4-(1,3-dioxolan-2-yl)-2,6-difluorophenyl]-
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid REF: IN-DA003895CAS: 1072946-41-8 | 97% | 185.00 €~239.00 € | Mon 03 Mar 25 |
 | 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid REF: 54-PC412039CAS: 1072946-41-8 | - - - | To inquire | Tue 04 Mar 25 |
 | (4-(1,3-Dioxolan-2-yl)-2,6-difluorophenyl)boronic acid REF: 10-F691535CAS: 1072946-41-8 | 96% | - - - | Discontinued product |
 | 4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid REF: 3D-FD93303CAS: 1072946-41-8 | Min. 95% | - - - | Discontinued product |
4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid
Ref: IN-DA003895
| 100mg | 185.00 € | ||
| 250mg | 239.00 € |
Ref: 54-PC412039
| Undefined size | To inquire |
(4-(1,3-Dioxolan-2-yl)-2,6-difluorophenyl)boronic acid
Ref: 10-F691535
| 1g | Discontinued | Request information | |
| 5g | Discontinued | Request information |
4-(1,3-Dioxolan-2-yl)-2,6-difluorophenylboronic acid
Ref: 3D-FD93303
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
