CAS 1072951-47-3

B-[8-(Trifluoromethyl)-6-quinolinyl]boronic acid

Description:

B-[8-(Trifluoromethyl)-6-quinolinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a quinoline derivative. This compound features a trifluoromethyl group, which enhances its lipophilicity and may influence its reactivity and biological activity. The boronic acid moiety is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and materials science. The quinoline structure contributes to its potential as a pharmacophore, with implications in drug design due to its ability to interact with biological targets. Additionally, the trifluoromethyl group can impart unique electronic properties, potentially affecting the compound's stability and reactivity. Overall, B-[8-(Trifluoromethyl)-6-quinolinyl]boronic acid is a versatile compound with significant implications in synthetic chemistry and drug development, particularly in the context of developing targeted therapies and molecular probes.

Formula: C₁₀H₇BF₃NO₂

InChI: InChI=1S/C10H7BF3NO2/c12-10(13,14)8-5-7(11(16)17)4-6-2-1-3-15-9(6)8/h1-5,16-17H

InChI key: InChIKey=MVVOQVNBQLPPSD-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C2=C(C=C(B(O)O)C1)C=CC=N2

Synonyms:

• Boronic acid, B-[8-(trifluoromethyl)-6-quinolinyl]-
• B-[8-(Trifluoromethyl)-6-quinolinyl]boronic acid
• [8-(Trifluoromethyl)quinolin-6-yl]boronic acid

8-Trifluoromethylquinoline-6-boronic acid

CAS: 1072951-47-3

Formula: C₁₀H₇BF₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 240.9743

Ref: IN-DA007WO1

8-Trifluoromethylquinoline-6-boronic acid

CAS: 1072951-47-3

8-Trifluoromethylquinoline-6-boronic acid

Purity: 98%

Molecular weight: 240.97g/mol

Ref: 54-PC412567

(8-(Trifluoromethyl)quinolin-6-yl)boronic acid

CAS: 1072951-47-3

Purity: 98%

Molecular weight: 240.9799957

Ref: 10-F690750