CAS 1072951-52-0: B-[2-Fluoro-5-(1-oxopentyl)phenyl]boronic acid

Description:B-[2-Fluoro-5-(1-oxopentyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a fluorine atom and a pentyl chain that terminates in a carbonyl group, contributing to its unique reactivity and potential biological activity. The presence of the fluorine atom can enhance the lipophilicity and metabolic stability of the molecule, while the boronic acid moiety allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the compound's structural characteristics may influence its solubility, stability, and interaction with biological targets, making it a subject of interest in drug discovery and development. Overall, B-[2-Fluoro-5-(1-oxopentyl)phenyl]boronic acid exemplifies the versatility of boronic acids in synthetic and medicinal chemistry.

Formula:C₁₁H₁₄BFO₃

InChI:InChI=1S/C11H14BFO3/c1-2-3-4-11(14)8-5-6-10(13)9(7-8)12(15)16/h5-7,15-16H,2-4H2,1H3

InChI key:InChIKey=IEVYFHJRPUPPAO-UHFFFAOYSA-N

SMILES:O=C(C1=CC=C(F)C(=C1)B(O)O)CCCC

Synonyms:
B-[2-Fluoro-5-(1-oxopentyl)phenyl]boronic acid
Boronic acid, B-[2-fluoro-5-(1-oxopentyl)phenyl]-

Found 4 products.

Product data	Purity	Price range	Estimated delivery
2-FLUORO-5-PENTANOYLPHENYLBORONIC ACID REF: IN-DA003BN7CAS: 1072951-52-0	- - -	To inquire	Tue 04 Mar 25
2-Fluoro-5-pentanoylphenylboronic acid REF: 54-PC412144CAS: 1072951-52-0	- - -	To inquire	Mon 03 Mar 25
(2-Fluoro-5-pentanoylphenyl)boronic acid REF: 10-F211188CAS: 1072951-52-0	95.0%	- - -	Discontinued product
2-Fluoro-5-pentanoylphenylboronic acid REF: 3D-FF84673CAS: 1072951-52-0	Min. 95%	- - -	Discontinued product