CAS 1072951-62-2: 3-(3-Fluorobenzyloxy)phenylboronic acid

Description:3-(3-Fluorobenzyloxy)phenylboronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a 3-fluorobenzyloxy group, which enhances its reactivity and solubility in organic solvents. The fluorine atom can influence the electronic properties of the molecule, potentially affecting its interactions in biological systems. This compound is typically utilized in cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds, and it may also serve as a building block in the synthesis of more complex organic molecules. Additionally, the presence of the boronic acid moiety allows for the formation of stable complexes with sugars, making it of interest in the development of sensors and drug delivery systems. Overall, 3-(3-Fluorobenzyloxy)phenylboronic acid is a versatile compound with significant implications in both synthetic and applied chemistry.

Formula:C₁₃H₁₂BFO₃

InChI:InChI=1S/C13H12BFO3/c15-12-5-1-3-10(7-12)9-18-13-6-2-4-11(8-13)14(16)17/h1-8,16-17H,9H2

InChI key:InChIKey=OGVHSTHPCKWLSC-UHFFFAOYSA-N

SMILES:FC1=CC=CC(=C1)COC2=CC=CC(=C2)B(O)O

Found 4 products.

Product data	Purity	Price range	Estimated delivery
(3-((3-Fluorobenzyl)oxy)phenyl)boronic acid REF: IN-DA003BPZCAS: 1072951-62-2	95%	47.00 €~227.00 €	Tue 04 Mar 25
3-(3'-Fluorobenzyloxy)phenylboronic acid REF: 54-PC430505CAS: 1072951-62-2	98%	56.00 €~180.00 €	Tue 11 Mar 25
(3-((3-Fluorobenzyl)oxy)phenyl)boronic acid REF: 10-F691493CAS: 1072951-62-2	98%	To inquire	Wed 12 Mar 25
3-(3-Fluorobenzyloxy)phenylboronic acid REF: 3D-FF85332CAS: 1072951-62-2	Min. 95%	- - -	Discontinued product