CAS 1072951-77-9
:B-[2-[(1-Naphthalenyloxy)methyl]phenyl]boronic acid
Description:
B-[2-[(1-Naphthalenyloxy)methyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. This compound features a naphthalenyloxy group attached to a phenyl ring, contributing to its structural complexity and potential for specific interactions in biological systems. The boronic acid moiety allows for participation in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in organic synthesis. Additionally, the presence of the naphthalene structure may enhance its hydrophobic properties, influencing its solubility and reactivity. This compound is of interest in the development of pharmaceuticals and materials science, particularly in the design of sensors and drug delivery systems. Its unique structural characteristics and reactivity profile make it a valuable compound in both research and industrial applications.
Formula:C17H15BO3
InChI:InChI=1S/C17H15BO3/c19-18(20)16-10-4-2-7-14(16)12-21-17-11-5-8-13-6-1-3-9-15(13)17/h1-11,19-20H,12H2
InChI key:InChIKey=QXLULGNNNOYHIY-UHFFFAOYSA-N
SMILES:O(CC1=C(B(O)O)C=CC=C1)C=2C3=C(C=CC2)C=CC=C3
Synonyms:- Boronic acid, B-[2-[(1-naphthalenyloxy)methyl]phenyl]-
- [2-[(Naphthalen-1-yloxy)methyl]phenyl]boronic acid
- B-[2-[(1-Naphthalenyloxy)methyl]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
