CAS 1072952-12-5

B-(2,4-Dichloro-5-nitrophenyl)boronic acid

Description:

B-(2,4-Dichloro-5-nitrophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with two chlorine atoms and one nitro group. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The presence of the boronic acid group allows it to participate in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The dichloro and nitro substituents on the phenyl ring can influence the compound's reactivity and electronic properties, potentially enhancing its utility in drug development and material science. Additionally, the compound's structure suggests it may exhibit specific interactions with biological targets, which could be explored for therapeutic applications. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.

Formula: C₆H₄BCl₂NO₄

InChI: InChI=1S/C6H4BCl2NO4/c8-4-2-5(9)6(10(13)14)1-3(4)7(11)12/h1-2,11-12H

InChI key: InChIKey=QZUUWAWNYJMANP-UHFFFAOYSA-N

SMILES: B(O)(O)C1=CC(N(=O)=O)=C(Cl)C=C1Cl

Synonyms:

• Boronic acid, B-(2,4-dichloro-5-nitrophenyl)-
• B-(2,4-Dichloro-5-nitrophenyl)boronic acid

2,4-Dichloro-5-nitrophenylboronic acid

CAS: 1072952-12-5

Formula: C₆H₄BCl₂NO₄

Purity: 95%

Molecular weight: 235.8173

Ref: IN-DA008S74

2,4-Dichloro-5-nitrophenylboronic acid

CAS: 1072952-12-5

2,4-Dichloro-5-nitrophenylboronic acid

Purity: ≥95%

Molecular weight: 235.82g/mol

Ref: 54-OR360105

(2,4-Dichloro-5-nitrophenyl)boronic acid

CAS: 1072952-12-5

Formula: C₆H₄BCl₂NO₄

Purity: ≥95%

Molecular weight: 235.81

Ref: 10-F211588