CAS 1072952-15-8
:B-(2-Amino-3,5-difluorophenyl)boronic acid
Description:
B-(2-Amino-3,5-difluorophenyl)boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is substituted with amino and difluoro groups. This compound typically exhibits properties such as being a white to off-white solid, soluble in polar solvents like water and alcohols, and possessing a moderate melting point. The amino group contributes to its potential as a ligand in coordination chemistry, while the boronic acid functionality allows for reversible binding with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The difluoro substitutions enhance its electronic properties and may influence its reactivity and biological activity. Additionally, compounds like this are often explored for their potential in drug development, particularly in targeting specific biological pathways or as intermediates in the synthesis of more complex molecules. Overall, B-(2-Amino-3,5-difluorophenyl)boronic acid is a versatile compound with significant implications in both research and industrial applications.
Formula:C6H6BF2NO2
InChI:InChI=1S/C6H6BF2NO2/c8-3-1-4(7(11)12)6(10)5(9)2-3/h1-2,11-12H,10H2
InChI key:InChIKey=UCYXMGAVMYFHST-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(N)C(F)=CC(F)=C1
Synonyms:- Boronic acid, B-(2-amino-3,5-difluorophenyl)-
- B-(2-Amino-3,5-difluorophenyl)boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
