
CAS 1072952-17-0
:B-[4-[(Methoxymethyl)thio]phenyl]boronic acid
Description:
B-[4-[(Methoxymethyl)thio]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group attached to a phenyl ring that is further substituted with a methoxymethylthio group. This compound typically exhibits properties such as being a white to off-white solid, with moderate solubility in polar solvents like water and alcohols due to the boronic acid moiety. The presence of the methoxymethylthio group enhances its reactivity and potential applications in organic synthesis, particularly in Suzuki coupling reactions, which are vital for forming carbon-carbon bonds. Additionally, boronic acids are known for their ability to form reversible complexes with diols, making them useful in various biochemical applications, including drug delivery and sensor development. The compound's structure suggests it may also have potential applications in medicinal chemistry, particularly in the development of targeted therapies due to its ability to interact with biological molecules. Overall, B-[4-[(Methoxymethyl)thio]phenyl]boronic acid is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C8H11BO3S
InChI:InChI=1S/C8H11BO3S/c1-12-6-13-8-4-2-7(3-5-8)9(10)11/h2-5,10-11H,6H2,1H3
InChI key:InChIKey=VWZLCFRKACUMDI-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(SCOC)C=C1
Synonyms:- Boronic acid, B-[4-[(methoxymethyl)thio]phenyl]-
- B-[4-[(Methoxymethyl)thio]phenyl]boronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
