CAS 1072952-41-0

B-[2-(Phenylmethoxy)-3-pyridinyl]boronic acid

Description:

B-[2-(Phenylmethoxy)-3-pyridinyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols and other nucleophiles. This compound features a pyridine ring substituted with a phenylmethoxy group, contributing to its potential applications in medicinal chemistry and organic synthesis. The boronic acid moiety allows for participation in Suzuki coupling reactions, making it valuable in the formation of carbon-carbon bonds. Additionally, the presence of the pyridine ring may impart specific electronic properties and enhance solubility in various solvents. The compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Overall, B-[2-(Phenylmethoxy)-3-pyridinyl]boronic acid exemplifies the versatility of boronic acids in both synthetic and biological contexts, highlighting their importance in modern chemistry.

Formula: C₁₂H₁₂BNO₃

InChI: InChI=1S/C12H12BNO3/c15-13(16)11-7-4-8-14-12(11)17-9-10-5-2-1-3-6-10/h1-8,15-16H,9H2

InChI key: InChIKey=YTIGWZQYGHOXOB-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(B(O)O)C=CC=N2

Synonyms:

• Boronic acid, B-[2-(phenylmethoxy)-3-pyridinyl]-
• B-[2-(Phenylmethoxy)-3-pyridinyl]boronic acid
• [2-[(Benzyl)oxy]pyridin-3-yl]boronic acid

2-BENZYLOXYPYRIDIN-3-YLBORONIC ACID

CAS: 1072952-41-0

Formula: C₁₂H₁₂BNO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 229.0396

Ref: IN-DA003BK1

2-Benzyloxypyridine-3-boronic acid

CAS: 1072952-41-0

2-Benzyloxypyridine-3-boronic acid

Purity: ≥95%

Molecular weight: 229.04g/mol

Ref: 54-OR360070

(2-(Benzyloxy)pyridin-3-yl)boronic acid

CAS: 1072952-41-0

Formula: C₁₂H₁₂BNO₃

Purity: 98%

Color and Shape: No data available.

Molecular weight: 229.04

Ref: 10-F211361