
CAS 1072952-47-6
:4-Borono-5-fluoro-3-pyridinecarboxylic acid
Description:
4-Borono-5-fluoro-3-pyridinecarboxylic acid is an organic compound characterized by the presence of a pyridine ring, a carboxylic acid functional group, a boron substituent, and a fluorine atom. The compound features a boronic acid moiety, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including medicinal chemistry and organic synthesis. The fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and biological activity. As a pyridine derivative, it exhibits aromatic characteristics, contributing to its stability and solubility in polar solvents. The carboxylic acid group provides acidic properties, allowing for protonation and deprotonation under different pH conditions. This compound may be utilized in the development of pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Its specific reactivity and interactions can be influenced by the presence of the boron and fluorine substituents, making it a valuable compound in chemical research and applications.
Formula:C6H5BFNO4
InChI:InChI=1S/C6H5BFNO4/c8-4-2-9-1-3(6(10)11)5(4)7(12)13/h1-2,12-13H,(H,10,11)
InChI key:InChIKey=YNASDKWZMQUBQV-UHFFFAOYSA-N
SMILES:B(O)(O)C=1C(C(O)=O)=CN=CC1F
Synonyms:- 3-Pyridinecarboxylic acid, 4-borono-5-fluoro-
- 4-Borono-5-fluoro-3-pyridinecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
