CymitQuimica logo

CAS 1072952-55-6

:

B-[5-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2-furanyl]boronic acid

Description:
B-[5-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2-furanyl]boronic acid is a boronic acid derivative characterized by its unique structure, which includes a furan ring and a silyl ether group. This compound typically exhibits properties associated with boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the dimethylsilyl group enhances its stability and solubility in organic solvents. Additionally, the furan moiety contributes to its reactivity and potential for further functionalization. As a boronic acid, it may also play a role in Suzuki coupling reactions, which are vital in the formation of carbon-carbon bonds in complex organic molecules. The compound's specific characteristics, such as melting point, solubility, and reactivity, would depend on its purity and the conditions under which it is handled. Overall, this compound represents a versatile building block in synthetic organic chemistry.
Formula:C11H21BO4Si
InChI:InChI=1S/C11H21BO4Si/c1-11(2,3)17(4,5)15-8-9-6-7-10(16-9)12(13)14/h6-7,13-14H,8H2,1-5H3
InChI key:InChIKey=GQIVYYWBSOMWOT-UHFFFAOYSA-N
SMILES:C(O[Si](C(C)(C)C)(C)C)C=1OC(B(O)O)=CC1
Synonyms:
  • [5-[[[(tert-Butyl)dimethylsilyl]oxy]methyl]-2-furanyl]boronic acid
  • B-[5-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]methyl]-2-furanyl]boronic acid
  • Boronic acid, B-[5-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]methyl]-2-furanyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.