CymitQuimica logo

CAS 1072960-84-9

:

4-(1H-Naphtho[1,8-de]-1,3,2-diazaborin-2(3H)-yl)benzenemethanol

Description:
4-(1H-Naphtho[1,8-de]-1,3,2-diazaborin-2(3H)-yl)benzenemethanol is a chemical compound characterized by its unique structure, which includes a naphthalene-derived diazaborin moiety and a benzenemethanol group. This compound features a boron-nitrogen framework, which is significant in various applications, particularly in organic synthesis and materials science. The presence of the hydroxymethyl group (benzenemethanol) suggests potential for hydrogen bonding and reactivity, making it a candidate for further functionalization. The compound's boron-containing structure may impart interesting electronic properties, potentially useful in optoelectronic applications. Additionally, the naphthalene component contributes to its aromatic character, which can influence solubility and stability. Overall, this compound exemplifies the intersection of boron chemistry and organic synthesis, with potential implications in drug development, catalysis, and the design of new materials. Its specific properties, such as solubility, melting point, and reactivity, would require empirical investigation for detailed characterization.
Formula:C17H15BN2O
InChI:InChI=1S/C17H15BN2O/c21-11-12-7-9-14(10-8-12)18-19-15-5-1-3-13-4-2-6-16(20-18)17(13)15/h1-10,19-21H,11H2
InChI key:InChIKey=BIKZGDCNQGYLJZ-UHFFFAOYSA-N
SMILES:C(O)C1=CC=C(B2NC=3C=4C(N2)=CC=CC4C=CC3)C=C1
Synonyms:
  • Benzenemethanol, 4-(1H-naphtho[1,8-de]-1,3,2-diazaborin-2(3H)-yl)-
  • [4-(1H-Naphtho[1,8-de][1,3,2]diazaborinin-2(3H)-yl)phenyl]methanol
  • 4-(1H-Naphtho[1,8-de]-1,3,2-diazaborin-2(3H)-yl)benzenemethanol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.