CAS 1073-00-3

2-Methylenecyclopropaneacetic acid

Description:

2-Methylenecyclopropaneacetic acid, with the CAS number 1073-00-3, is an organic compound characterized by its unique structure that includes a cyclopropane ring and a methylene group. This compound features a carboxylic acid functional group, which contributes to its acidity and reactivity. The presence of the methylene bridge enhances its potential for various chemical reactions, making it a useful intermediate in organic synthesis. Typically, compounds like 2-methylenecyclopropaneacetic acid exhibit properties such as solubility in polar solvents due to the carboxylic acid group, and they may participate in reactions like esterification or amidation. Additionally, the cyclopropane moiety can impart strain, influencing the compound's reactivity and stability. While specific physical properties such as boiling point and melting point may vary, the compound is generally of interest in the fields of organic chemistry and materials science for its potential applications in synthesizing more complex molecules.

Formula: C₆H₈O₂

InChI: InChI=1S/C6H8O2/c1-4-2-5(4)3-6(7)8/h5H,1-3H2,(H,7,8)

InChI key: InChIKey=QJBXAEKEXKLLLZ-UHFFFAOYSA-N

SMILES: C(C(O)=O)C1C(=C)C1

Synonyms:

• (2-Methylenecyclopropyl)acetic acid
• (Methylenecyclopropyl)acetic acid
• 2-(2-Methylenecyclopropyl)acetic acid
• 2-Methylenecyclopropaneacetic acid
• Cyclopropaneacetic acid, 2-methylene-
• Methylenecyclopropylacetic Acid

(Methylenecyclopropyl) acetic acid

CAS: 1073-00-3

Formula: C6H8O2

Purity: >95%

Color and Shape: Liquid

Molecular weight: 112.13

Ref: 48-11-0513

2-Methylenecyclopropaneacetic Acid

CAS: 1073-00-3

Applications 2-Methylenecyclopropaneacetic Acid is an intermediate in the preparation of novel agents for the therapy of non-insulin dependent diabetes mellitus.
References Bell, P., et al.: Bioorg. Med. Chem. Lett., 3, 1007 (1993);

Formula: C₆H₈O₂

Color and Shape: Colourless

Molecular weight: 112.126

Ref: TR-M304360