
CAS 1073-38-7
:2-Mercapto-2,4,6-cycloheptatrien-1-one
Description:
2-Mercapto-2,4,6-cycloheptatrien-1-one, with the CAS number 1073-38-7, is an organic compound characterized by its unique structure that includes a cycloheptatriene ring and a thiol (-SH) functional group. This compound exhibits properties typical of both aromatic and aliphatic systems, contributing to its reactivity and stability. The presence of the mercapto group imparts significant nucleophilicity, making it a valuable intermediate in various organic synthesis reactions. Additionally, the compound may exhibit antioxidant properties due to the thiol group, which can participate in redox reactions. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically handled with care due to the potential for toxicity associated with thiol-containing substances. Overall, 2-Mercapto-2,4,6-cycloheptatrien-1-one is an intriguing compound with diverse chemical properties and potential applications in various fields of chemistry.
Formula:C7H6OS
InChI:InChI=1S/C7H6OS/c8-6-4-2-1-3-5-7(6)9/h1-5H,(H,8,9)
InChI key:InChIKey=DNBQDZRBEGFUEA-UHFFFAOYSA-N
SMILES:O=C1C(S)=CC=CC=C1
Synonyms:- Thiotropolone
- 2-Mercaptotropone
- 2-Sulfanylcyclohepta-2,4,6-trien-1-one
- 2,4,6-Cycloheptatrien-1-one, 2-mercapto-
- 2-Mercapto-2,4,6-cycloheptatrien-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.