CymitQuimica logo

CAS 1073-96-7

:

3,5-Dihydroxy-2-methyl-4H-pyran-4-one

Description:
3,5-Dihydroxy-2-methyl-4H-pyran-4-one, also known as mucochloric acid, is an organic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound has two hydroxyl (-OH) groups at the 3 and 5 positions, contributing to its solubility in water and its potential reactivity in various chemical reactions. The presence of a methyl group at the 2 position further influences its chemical properties and biological activity. 3,5-Dihydroxy-2-methyl-4H-pyran-4-one is known for its antioxidant properties and has been studied for its potential applications in pharmaceuticals and food chemistry. Its ability to chelate metal ions and participate in redox reactions makes it of interest in various fields, including biochemistry and materials science. Additionally, the compound's stability and reactivity can vary depending on environmental conditions such as pH and temperature, which are important considerations in its practical applications.
Formula:C6H6O4
InChI:InChI=1S/C6H6O4/c1-3-5(8)6(9)4(7)2-10-3/h2,7-8H,1H3
InChI key:InChIKey=SSSNQLHKSUJJTE-UHFFFAOYSA-N
SMILES:O=C1C(O)=C(C)OC=C1O
Synonyms:
  • 4H-Pyran-4-one, 3,5-dihydroxy-2-methyl-
  • Pyrone 1
  • 3,5-Dihydroxy-2-methyl-4H-pyran-4-one
  • 5-Hydroxymaltol
  • 3,5-Dihydroxy-2-methyl-4-pyrone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.