CymitQuimica logo

CAS 1073062-42-6

:

2-(3-broMo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine

Description:
2-(3-Bromo-5-chlorophenyl)-4,6-diphenyl-1,3,5-triazine is an organic compound characterized by its triazine core, which consists of a six-membered ring containing three nitrogen atoms and three carbon atoms. This compound features a bromine and a chlorine substituent on a phenyl group, contributing to its unique reactivity and potential applications in various fields, including pharmaceuticals and materials science. The presence of multiple phenyl groups enhances its stability and may influence its electronic properties, making it suitable for use in organic electronics or as a dye. The compound's structure suggests it may exhibit interesting photophysical properties, which could be leveraged in photochemical applications. Additionally, the halogen substituents can enhance its biological activity, making it a candidate for further investigation in medicinal chemistry. Overall, this compound's distinctive features, including its halogenated aromatic system and triazine framework, position it as a valuable subject for research in both synthetic and applied chemistry.
Formula:C21H13BrClN3
InChI:InChI=1S/C21H13BrClN3/c22-17-11-16(12-18(23)13-17)21-25-19(14-7-3-1-4-8-14)24-20(26-21)15-9-5-2-6-10-15/h1-13H
InChI key:BLKKWMCDZNDYEQ-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=NC(=NC(=N2)C3=CC(=CC(=C3)Br)Cl)C4=CC=CC=C4
Found 4 products.