CAS 1073145-56-8

4-(1,1-Dimethylethyl)-2-ethoxybenzaldehyde

Description:

4-(1,1-Dimethylethyl)-2-ethoxybenzaldehyde, with the CAS number 1073145-56-8, is an organic compound characterized by its aromatic structure, which includes a benzaldehyde functional group. This compound features a tert-butyl group (1,1-dimethylethyl) and an ethoxy group attached to the benzene ring, contributing to its unique chemical properties. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as oxidation and condensation. The tert-butyl group enhances the steric hindrance around the aromatic ring, potentially influencing its reactivity and solubility in organic solvents. Additionally, the ethoxy group can provide some degree of polarity, affecting the compound's interactions with other substances. This compound may be of interest in synthetic organic chemistry and could serve as an intermediate in the production of more complex molecules or materials. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards.

Formula: C₁₃H₁₈O₂

InChI: InChI=1S/C13H18O2/c1-5-15-12-8-11(13(2,3)4)7-6-10(12)9-14/h6-9H,5H2,1-4H3

InChI key: InChIKey=ZOUJQQWUGBFCTR-UHFFFAOYSA-N

SMILES: O(CC)C1=C(C=O)C=CC(C(C)(C)C)=C1

Synonyms:

• Benzaldehyde, 4-(1,1-dimethylethyl)-2-ethoxy-
• 4-(1,1-Dimethylethyl)-2-ethoxybenzaldehyde