CymitQuimica logo

CAS 1073159-71-3

:

N-[2-(Aminomethyl)-3-pyridinyl]-N-methylmethanesulfonamide

Description:
N-[2-(Aminomethyl)-3-pyridinyl]-N-methylmethanesulfonamide, identified by its CAS number 1073159-71-3, is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. This compound features a pyridine ring, which contributes to its potential biological activity, and an aminomethyl substituent that enhances its solubility and reactivity. The presence of the N-methyl group indicates that it has a tertiary amine structure, which can influence its pharmacokinetic properties, such as absorption and distribution in biological systems. The methanesulfonamide moiety is significant for its ability to form hydrogen bonds, potentially enhancing interactions with biological targets. Overall, this compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry and drug development. Its specific characteristics, such as melting point, solubility, and stability, would require empirical data for precise evaluation.
Formula:C8H13N3O2S
InChI:InChI=1S/C8H13N3O2S/c1-11(14(2,12)13)8-4-3-5-10-7(8)6-9/h3-5H,6,9H2,1-2H3
InChI key:InChIKey=UDTDRWMWYUZZOE-UHFFFAOYSA-N
SMILES:N(S(C)(=O)=O)(C)C1=C(CN)N=CC=C1
Synonyms:
  • Methanesulfonamide, N-[2-(aminomethyl)-3-pyridinyl]-N-methyl-
  • N-[2-(Aminomethyl)-3-pyridinyl]-N-methylmethanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.