CAS 107317-58-8
:Methyl 4-Bromo-3-(Trifluoromethyl)benzoate
Description:
Methyl 4-Bromo-3-(Trifluoromethyl)benzoate, with the CAS number 107317-58-8, is an organic compound characterized by its aromatic structure, which includes a bromine atom and a trifluoromethyl group attached to a benzoate moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its moderate to high polarity due to the presence of electronegative bromine and fluorine atoms, which can influence its reactivity and solubility in various solvents. Methyl 4-Bromo-3-(Trifluoromethyl)benzoate is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to participate in electrophilic aromatic substitution reactions. Additionally, the trifluoromethyl group enhances the compound's lipophilicity and metabolic stability, making it a valuable building block in medicinal chemistry. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C9H6BrF3O2
InChI:InChI=1/C9H6BrF3O2/c1-15-8(14)5-2-3-7(10)6(4-5)9(11,12)13/h2-4H,1H3
SMILES:COC(=O)c1ccc(c(c1)C(F)(F)F)Br
Synonyms:- Benzoic Acid, 4-Bromo-3-(Trifluoromethyl)-, Methyl Ester
- Fxffr Be Evo1
- Methyl 4-bromo-alpha,alpha,alpha-trifluoro-m-toluate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 4-bromo-3-(trifluoromethyl)benzoate
CAS:Formula:C9H6BrF3O2Purity:98%Color and Shape:SolidMolecular weight:283.0419Methyl 4-bromo-3-(trifluoromethyl)benzoate
CAS:Methyl 4-bromo-3-(trifluoromethyl)benzoateFormula:C9H6BrF3O2Purity:98%Color and Shape: solidMolecular weight:283.04g/molMethyl 4-bromo-3-(trifluoromethyl)benzoate
CAS:Formula:C9H6BrF3O2Purity:98%Color and Shape:SolidMolecular weight:283.044Methyl 4-bromo-3-trifluoromethyl benzoate
CAS:Methyl 4-bromo-3-trifluoromethyl benzoate is a peroxisome proliferator-activated receptor (PPAR) modulator. It has been shown to have effects on PPARs, which are receptors that bind to fatty acids and regulate the production of cell membrane components such as phospholipids and cholesterol. Methyl 4-bromo-3-trifluoromethyl benzoate has been shown to increase the expression of PPARγ, which is a type of PPAR that regulates the production of enzymes involved in fatty acid metabolism, thereby reducing triglycerides and cholesterol levels.Formula:C9H6BrF3O2Purity:Min. 95%Molecular weight:283.04 g/mol



