
CAS 1073182-61-2
:Methyl 3-amino-2-bromo-6-chloro-4-pyridinecarboxylate
Description:
Methyl 3-amino-2-bromo-6-chloro-4-pyridinecarboxylate is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features several functional groups, including an amino group (-NH2), a bromo substituent (-Br), and a chloro substituent (-Cl), which contribute to its reactivity and potential applications in organic synthesis. The presence of the methyl ester group (-COOCH3) indicates that it can undergo hydrolysis to form the corresponding carboxylic acid. The specific arrangement of these substituents on the pyridine ring influences the compound's physical and chemical properties, such as solubility, boiling point, and reactivity. Methyl 3-amino-2-bromo-6-chloro-4-pyridinecarboxylate may be of interest in pharmaceutical research and development due to its potential biological activity, particularly in the context of drug design and synthesis. As with many halogenated compounds, it may also exhibit unique properties that could be exploited in various chemical reactions.
Formula:C7H6BrClN2O2
InChI:InChI=1S/C7H6BrClN2O2/c1-13-7(12)3-2-4(9)11-6(8)5(3)10/h2H,10H2,1H3
InChI key:InChIKey=GTTUKRFIGRLUIP-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(N)=C(Br)N=C(Cl)C1
Synonyms:- 4-Pyridinecarboxylic acid, 3-amino-2-bromo-6-chloro-, methyl ester
- Methyl 3-amino-2-bromo-6-chloro-4-pyridinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.