CymitQuimica logo

CAS 1073182-92-9

:

3-Amino-4,6-dibromo-2-pyridinecarbonitrile

Description:
3-Amino-4,6-dibromo-2-pyridinecarbonitrile is a heterocyclic organic compound characterized by the presence of a pyridine ring substituted with amino, bromine, and cyano functional groups. The compound features a pyridine backbone, which is a six-membered aromatic ring containing one nitrogen atom. The amino group (-NH2) is typically a strong electron-donating group, enhancing the compound's reactivity and potential for forming hydrogen bonds. The dibromo substitutions at the 4 and 6 positions introduce significant steric and electronic effects, which can influence the compound's chemical behavior and interactions. The cyano group (-C≡N) at the 2 position contributes to the compound's polarity and can participate in various chemical reactions, such as nucleophilic additions. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Additionally, its unique combination of functional groups suggests potential applications in materials science and organic synthesis. Safety and handling precautions should be observed due to the presence of bromine, which can be hazardous.
Formula:C6H3Br2N3
InChI:InChI=1S/C6H3Br2N3/c7-3-1-5(8)11-4(2-9)6(3)10/h1H,10H2
InChI key:InChIKey=ZVICGKORJLZTJU-UHFFFAOYSA-N
SMILES:C(#N)C1=C(N)C(Br)=CC(Br)=N1
Synonyms:
  • 3-Amino-4,6-dibromo-2-pyridinecarbonitrile
  • 3-Amino-4,6-dibromo-2-cyanopyridine
  • 2-Pyridinecarbonitrile, 3-amino-4,6-dibromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.