CAS 1073182-98-5
:3-Pyridinecarboxylic acid, 4-amino-5-chloro-, hydrochloride (1:1)
Description:
3-Pyridinecarboxylic acid, 4-amino-5-chloro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a carboxylic acid functional group and an amino group, contributing to its potential as a biologically active molecule. The presence of a chlorine atom at the 5-position of the pyridine ring introduces halogen characteristics, which can influence the compound's reactivity and solubility. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals and research. The compound's molecular interactions may be significant in biological systems, making it of interest in medicinal chemistry. Its specific properties, such as melting point, solubility, and stability, would depend on the conditions under which it is studied or utilized. Overall, this compound exemplifies the diverse functionalities that can arise from modifications to heterocyclic structures.
Formula:C6H5ClN2O2·ClH
InChI:InChI=1S/C6H5ClN2O2.ClH/c7-4-2-9-1-3(5(4)8)6(10)11;/h1-2H,(H2,8,9)(H,10,11);1H
InChI key:InChIKey=NXRONHQZIRSQDP-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C(N)=C(Cl)C=NC1.Cl
Synonyms:- 3-Pyridinecarboxylic acid, 4-amino-5-chloro-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
