CAS 107328-14-3

2-BENZYLAMINO-N-CYCLOHEXYL-SUCCINAMIC ACID

Description:

2-Benzylamino-N-cyclohexyl-succinamic acid, identified by its CAS number 107328-14-3, is a chemical compound that features a succinamic acid backbone with specific substituents that enhance its biological activity. This compound typically exhibits characteristics such as being a white to off-white solid, with moderate solubility in polar solvents like water and organic solvents. The presence of the benzyl and cyclohexyl groups contributes to its lipophilicity, potentially influencing its pharmacokinetic properties. It may also display functional properties such as being a potential inhibitor or modulator in various biochemical pathways, making it of interest in medicinal chemistry. The compound's structure suggests it may participate in hydrogen bonding and other intermolecular interactions, which can affect its reactivity and stability. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly. Overall, 2-benzylamino-N-cyclohexyl-succinamic acid represents a unique structure with potential applications in pharmaceutical research.

Formula: C₁₇H₂₄N₂O₃

InChI: InChI=1/C17H24N2O3/c20-16(19-14-9-5-2-6-10-14)11-15(17(21)22)18-12-13-7-3-1-4-8-13/h1,3-4,7-8,14-15,18H,2,5-6,9-12H2,(H,19,20)(H,21,22)/t15-/m1/s1

Synonyms:

• N~2~-benzyl-N-cyclohexyl-L-asparagine
• TIMTEC-BB SBB012317
• N~2~-benzyl-N-cyclohexyl-D-asparagine
• N2-BENZYL-N4-CYCLOHEXYLASPARAGINE