
CAS 1073338-95-0
:5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Description:
5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine is a complex organic compound characterized by its unique structural features, including a pyrrolopyridine core, a chloro substituent, and a boron-containing dioxaborolane moiety. The presence of the tetramethyl dioxaborolane group suggests potential applications in organoboron chemistry, particularly in cross-coupling reactions. The tris(1-methylethyl)silyl group indicates a high degree of steric hindrance, which may influence the compound's reactivity and solubility. This compound is likely to exhibit interesting electronic properties due to the conjugated system of the pyrrolopyridine structure, making it a candidate for various applications in organic synthesis and materials science. Additionally, the presence of chlorine may impart specific reactivity patterns, such as nucleophilic substitution. Overall, this compound's intricate structure and functional groups suggest potential utility in advanced chemical applications, including pharmaceuticals and agrochemicals.
Formula:C22H36BClN2O2Si
InChI:InChI=1S/C22H36BClN2O2Si/c1-14(2)29(15(3)4,16(5)6)26-13-19(18-11-17(24)12-25-20(18)26)23-27-21(7,8)22(9,10)28-23/h11-16H,1-10H3
InChI key:InChIKey=PGOCNAKMPYFFNM-UHFFFAOYSA-N
SMILES:[Si](C(C)C)(C(C)C)(C(C)C)N1C=2C(C(=C1)B3OC(C)(C)C(C)(C)O3)=CC(Cl)=CN2
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine, 5-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[tris(1-methylethyl)silyl]-
- 5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-[tris(1-methylethyl)silyl]-1H-pyrrolo[2,3-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-(triisopropylsilyl)-1h-pyrrolo[2,3-b]pyri
CAS:Formula:C22H36BClN2O2SiMolecular weight:434.8829
