
CAS 1073338-98-3
:3-Bromo-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine
Description:
3-Bromo-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine is an organic compound characterized by its complex structure, which includes a bromine atom, a dimethylamino group, and a boron-containing dioxaborolane moiety. The presence of the bromine atom suggests potential reactivity in nucleophilic substitution reactions, while the dimethylamino group can influence the compound's basicity and solubility in various solvents. The dioxaborolane unit is notable for its ability to participate in cross-coupling reactions, making this compound potentially useful in synthetic organic chemistry, particularly in the development of pharmaceuticals or advanced materials. The compound's molecular structure indicates it may exhibit specific electronic properties due to the interactions between the aromatic system and the boron-containing group. Additionally, the steric bulk provided by the tetramethyl groups may affect its reactivity and interactions with other molecules. Overall, this compound represents a versatile building block in organic synthesis, with applications in various chemical research fields.
Formula:C14H21BBrNO2
InChI:InChI=1S/C14H21BBrNO2/c1-13(2)14(3,4)19-15(18-13)10-7-11(16)9-12(8-10)17(5)6/h7-9H,1-6H3
InChI key:InChIKey=CARQXUBNNUVNJU-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(N(C)C)=CC(Br)=C2
Synonyms:- Benzenamine, 3-bromo-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Bromo-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Bromo-N,N-dimethyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzenamine
CAS:Formula:C14H21BBrNO2Molecular weight:326.0370
