CAS 1073353-44-2: 2-[3-(Chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:2-[3-(Chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound includes a chloromethyl group attached to a phenyl ring, enhancing its reactivity and potential applications in organic synthesis. The presence of tetramethyl substituents contributes to its steric bulk, which can influence its reactivity and solubility in various solvents. Typically, compounds of this nature are utilized in cross-coupling reactions, particularly in the formation of carbon-carbon bonds, making them valuable in the synthesis of pharmaceuticals and agrochemicals. The chloromethyl group can serve as a leaving group or a site for further functionalization, allowing for diverse synthetic pathways. Additionally, the compound's stability and reactivity can be affected by environmental factors such as temperature and pH, which are important considerations in practical applications. Overall, this compound exemplifies the versatility of organoboron chemistry in modern synthetic methodologies.
Formula:C13H18BClO2
InChI:InChI=1S/C13H18BClO2/c1-12(2)13(3,4)17-14(16-12)11-7-5-6-10(8-11)9-15/h5-8H,9H2,1-4H3
InChI key:InChIKey=KWUGBVHPELQIAF-UHFFFAOYSA-N
SMILES:ClCC=1C=CC=C(C1)B2OC(C)(C)C(O2)(C)C
- Synonyms:
- 2-[3-(Chloromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[3-(chloromethyl)phenyl]-4,4,5,5-tetramethyl-

2-(3-(Chloromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Ref: IN-DA007ENP
1g | 136.00 € | ||
5g | 277.00 € | ||
25g | To inquire | ||
250mg | 66.00 € |

Ref: 54-OR360969
1g | 188.00 € | ||
5g | 463.00 € | ||
25g | 1,446.00 € |

2-(3-(Chloromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Ref: 10-F228472
1g | 136.00 € | ||
5g | 351.00 € | ||
25g | 1,088.00 € | ||
250mg | 64.00 € |

2-(3-(Chloromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Ref: 3D-YSB35344
5g | 465.00 € |