CAS 1073354-27-4
:N-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine
Description:
N-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with an amine group and a benzyl moiety, as well as a dioxaborolane group. The presence of the dioxaborolane moiety suggests potential applications in organic synthesis, particularly in cross-coupling reactions, due to its ability to participate in boron-mediated transformations. This compound is likely to exhibit moderate to high polarity due to the presence of both polar amine and dioxaborolane functional groups, which may influence its solubility in various solvents. Additionally, the tetramethyl groups contribute to steric hindrance, potentially affecting its reactivity and interaction with other molecules. The compound's molecular structure may also impart specific biological activities, making it of interest in medicinal chemistry. As with many boron-containing compounds, it may exhibit unique properties such as Lewis acidity, which can be exploited in catalysis or material science applications.
Formula:C18H23BN2O2
InChI:InChI=1/C18H23BN2O2/c1-17(2)18(3,4)23-19(22-17)15-10-11-16(21-13-15)20-12-14-8-6-5-7-9-14/h5-11,13H,12H2,1-4H3,(H,20,21)
SMILES:CC1(C)C(C)(C)OB(c2ccc(=NCc3ccccc3)[nH]c2)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-(Benzylamino)pyridine-3-boronic acid pinacol ester, 95%
CAS:Used as pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a partFormula:C18H23BN2O2Purity:95%Color and Shape:Pale yellow to yellow, Crystals or powder or crystalline powderMolecular weight:310.202-(BENZYLAMINO)PYRIDINE-5-BORONIC ACID PINACOL ESTER
CAS:Formula:C18H23BN2O2Purity:95%Color and Shape:SolidMolecular weight:310.1984N-Benzyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine
CAS:N-Benzyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-aminePurity:≥95%Color and Shape:White SolidMolecular weight:310.20g/molN-benzyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine
CAS:Purity:95%Molecular weight:310.2000122



