CymitQuimica logo

CAS 1073354-32-1

:

N-[(4-Methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N-[(4-Methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine is a chemical compound characterized by its complex structure, which includes a pyridine ring, an amine group, and a boron-containing moiety. The presence of the 4-methylphenyl group suggests that it has aromatic characteristics, contributing to its stability and potential interactions in various chemical environments. The tetramethyl-1,3,2-dioxaborolane group indicates that this compound may exhibit unique reactivity due to the boron atom, which can participate in coordination chemistry and may be involved in various organic transformations. This compound is likely to be soluble in organic solvents, and its properties may be influenced by the steric hindrance introduced by the bulky tetramethyl groups. Additionally, the amine functionality may impart basicity, allowing for potential interactions with acids or electrophiles. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, materials science, or as a reagent in organic synthesis.
Formula:C19H25BN2O2
InChI:InChI=1S/C19H25BN2O2/c1-14-6-8-15(9-7-14)12-21-17-11-10-16(13-22-17)20-23-18(2,3)19(4,5)24-20/h6-11,13H,12H2,1-5H3,(H,21,22)
InChI key:InChIKey=AFMJUGQUPACTDK-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(NCC3=CC=C(C)C=C3)=NC2
Synonyms:
  • N-[(4-Methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
  • 2-Pyridinamine, N-[(4-methylphenyl)methyl]-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.