CymitQuimica logo

CAS 1073354-35-4

:

N-1-Piperidinyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine

Description:
N-1-Piperidinyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine, with the CAS number 1073354-35-4, is a chemical compound characterized by its unique structural features, which include a piperidine ring and a pyridinamine moiety. The presence of the dioxaborolane group contributes to its potential reactivity and applications in organic synthesis, particularly in the context of boron chemistry. This compound may exhibit properties such as moderate to high solubility in organic solvents, depending on the specific conditions and the presence of functional groups. Its molecular structure suggests potential applications in medicinal chemistry, possibly as a pharmaceutical intermediate or a ligand in coordination chemistry. Additionally, the presence of nitrogen atoms in both the piperidine and pyridine rings may impart basicity, influencing its interaction with other chemical species. Overall, this compound represents a versatile scaffold for further chemical modifications and investigations in various fields of research.
Formula:C16H26BN3O2
InChI:InChI=1S/C16H26BN3O2/c1-15(2)16(3,4)22-17(21-15)13-8-9-14(18-12-13)19-20-10-6-5-7-11-20/h8-9,12H,5-7,10-11H2,1-4H3,(H,18,19)
InChI key:InChIKey=ZKCANNIBKDXFNZ-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C=2C=CC(NN3CCCCC3)=NC2
Synonyms:
  • N-1-Piperidinyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinamine
  • 2-Pyridinamine, N-1-piperidinyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.