CymitQuimica logo

CAS 1073354-78-5

:

2-methylsulfanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

Description:
2-Methylsulfanyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a methylsulfanyl group and a boron-containing moiety. The presence of the methylsulfanyl group contributes to its potential as a nucleophile in various chemical reactions, while the dioxaborolane unit enhances its reactivity, particularly in cross-coupling reactions and as a boron source in organic synthesis. This compound is likely to exhibit moderate polarity due to the heteroatoms in its structure, influencing its solubility in organic solvents. Additionally, the presence of the boron atom may impart specific coordination chemistry properties, making it useful in organometallic chemistry. Its applications could extend to medicinal chemistry, materials science, and catalysis, although specific applications would depend on further research and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C12H18BNO2S
InChI:InChI=1/C12H18BNO2S/c1-11(2)12(3,4)16-13(15-11)9-7-6-8-14-10(9)17-5/h6-8H,1-5H3
SMILES:CC1(C)C(C)(C)OB(c2cccnc2SC)O1
Synonyms:
  • 2-(Methyl?thio)?pyridine-?3-boronic? acid pin?acol ester
  • 2-(Methylsulfanyl)pyridine-3-boronic acid pinacol ester
  • T6Nj Bs1 C- Bt5Obotj D1 D1 E1 E1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.