CAS 1073354-84-3
:5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-ol
Description:
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-ol is a chemical compound characterized by its unique structure, which includes a pyrimidine ring and a boron-containing dioxaborolane moiety. This compound typically exhibits properties associated with both heterocyclic compounds and organoboron chemistry. The presence of the pyrimidine ring suggests potential applications in pharmaceuticals and agrochemicals, as pyrimidines are known for their biological activity. The dioxaborolane group can enhance the compound's reactivity and solubility, making it useful in various synthetic applications, particularly in cross-coupling reactions and as a building block in organic synthesis. Additionally, the tetramethyl substitution provides steric hindrance, which can influence the compound's reactivity and stability. Overall, this compound is of interest in medicinal chemistry and materials science due to its potential utility in drug development and as a precursor in the synthesis of more complex molecules.
Formula:C10H15BN2O3
InChI:InChI=1/C10H15BN2O3/c1-9(2)10(3,4)16-11(15-9)7-5-12-8(14)13-6-7/h5-6H,1-4H3,(H,12,13,14)
SMILES:CC1(C)C(C)(C)OB(c2cnc(nc2)O)O1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Hydroxypyrimidine-5-boronic acid pinacol ester, 95%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C10H15BN2O3Purity:95%Color and Shape:White to pale yellow or pale cream, PowderMolecular weight:222.052-Hydroxypyrimidine-5-boronic acid pinacol ester
CAS:Formula:C10H15BN2O3Color and Shape:SolidMolecular weight:222.04872-Hydroxypyrimidine-5-boronic acid, pinacol ester
CAS:2-Hydroxypyrimidine-5-boronic acid, pinacol esterPurity:≥95%Molecular weight:222.05g/mol5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-ol
CAS:Formula:C10H15BN2O3Purity:95.0%Color and Shape:Solid, White powderMolecular weight:222.05



