
CAS 1073355-22-2
:2-[2-[4-(1,1-Dimethylethyl)phenyl]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[2-[4-(1,1-Dimethylethyl)phenyl]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a boron-containing organic compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound typically exhibits properties associated with boron compounds, such as potential applications in organic synthesis and materials science. The presence of bulky tert-butyl groups and a phenyl ring contributes to its steric hindrance, which can influence its reactivity and solubility in various solvents. The dioxaborolane moiety is known for its ability to participate in reactions such as cross-coupling, making it valuable in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific optical properties due to its structural features, which can be explored for applications in photonics or as a ligand in coordination chemistry. Overall, this compound represents a versatile building block in synthetic organic chemistry, with potential implications in various fields.
Formula:C18H29BO2
InChI:InChI=1S/C18H29BO2/c1-16(2,3)15-10-8-14(9-11-15)12-13-19-20-17(4,5)18(6,7)21-19/h8-11H,12-13H2,1-7H3
InChI key:InChIKey=MWFMSBIXSIIMIW-UHFFFAOYSA-N
SMILES:C(CC1=CC=C(C(C)(C)C)C=C1)B2OC(C)(C)C(C)(C)O2
Synonyms:- 2-[4-(tert-Butyl)phenethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 2-[2-[4-(1,1-Dimethylethyl)phenyl]ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 2-[2-(4-tert-Butylphenyl)ethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[2-[4-(1,1-dimethylethyl)phenyl]ethyl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(4-(tert-Butyl)phenethyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS:Formula:C18H29BO2Molecular weight:288.2327
