
CAS 1073355-27-7
:2-[[(1S,4R)-3,3-Dimethylbicyclo[2.2.1]hept-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Description:
2-[[(1S,4R)-3,3-Dimethylbicyclo[2.2.1]hept-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a complex organic compound characterized by its bicyclic structure and boron-containing dioxaborolane moiety. The presence of the bicyclo[2.2.1]heptane framework contributes to its rigidity and potential stereochemical properties, while the dioxaborolane group is known for its reactivity in various organic transformations, particularly in the formation of boron-containing intermediates. This compound may exhibit unique solubility characteristics due to its bulky substituents, which can influence its interactions with solvents and other reagents. Additionally, the stereochemistry indicated by the (1S,4R) configuration suggests that the compound may have specific spatial arrangements that could affect its biological activity or reactivity in chemical processes. Overall, this substance is of interest in synthetic organic chemistry, particularly in applications involving boron chemistry and the development of novel materials or pharmaceuticals.
Formula:C16H29BO2
InChI:InChI=1S/C16H29BO2/c1-14(2)12-8-7-11(9-12)13(14)10-17-18-15(3,4)16(5,6)19-17/h11-13H,7-10H2,1-6H3/t11-,12+,13?/m0/s1
InChI key:InChIKey=GUIVFDQUMQHBCG-LAGVYOHYSA-N
SMILES:C(C1[C@@]2(C[C@](C1(C)C)(CC2)[H])[H])B3OC(C)(C)C(C)(C)O3
Synonyms:- 2-[[(1S,4R)-3,3-Dimethylbicyclo[2.2.1]hept-2-yl]methyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
- 1,3,2-Dioxaborolane, 2-[[(1S,4R)-3,3-dimethylbicyclo[2.2.1]hept-2-yl]methyl]-4,4,5,5-tetramethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(3,3-DIMETHYLBICYCLO[2.2.1]HEPT-2-YLMETHYL)-4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLANE
CAS:Formula:C16H29BO2Molecular weight:264.2113
