
CAS 1073371-84-2
:3-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Description:
3-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is an organic compound characterized by its unique structural features, which include a pyridine ring substituted with a methyl group and a dioxaborolane moiety. The presence of the dioxaborolane group suggests that this compound may exhibit properties related to boron chemistry, such as potential reactivity in cross-coupling reactions or as a boron source in various synthetic applications. The compound's molecular structure contributes to its potential solubility in organic solvents, while the pyridine ring may impart basicity and aromatic characteristics. Additionally, the presence of multiple methyl groups in the dioxaborolane enhances steric hindrance, which can influence its reactivity and interactions with other chemical species. Overall, this compound may be of interest in organic synthesis, particularly in the development of new materials or pharmaceuticals, due to its unique functional groups and potential reactivity patterns.
Formula:C12H18BNO2
InChI:InChI=1S/C12H18BNO2/c1-9-7-6-8-14-10(9)13-15-11(2,3)12(4,5)16-13/h6-8H,1-5H3
InChI key:InChIKey=MPNZLEVRIPNUSA-UHFFFAOYSA-N
SMILES:CC1=C(B2OC(C)(C)C(C)(C)O2)N=CC=C1
Synonyms:- Pyridine, 3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
- 3-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-Methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS:Formula:C12H18BNO2Molecular weight:219.0878
