CymitQuimica logo

CAS 1073372-09-4

:

2-Pyridinamine, 5-chloro-N-cyclopropyl-3-fluoro-, hydrochloride (1:1)

Description:
2-Pyridinamine, 5-chloro-N-cyclopropyl-3-fluoro-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chlorine atom at the 5-position and a fluorine atom at the 3-position of the pyridine ring contributes to its unique reactivity and potential biological activity. The cyclopropyl group attached to the nitrogen atom enhances its steric properties, which may influence its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting certain receptors or enzymes. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.
Formula:C8H8ClFN2·ClH
InChI:InChI=1S/C8H8ClFN2.ClH/c9-5-3-7(10)8(11-4-5)12-6-1-2-6;/h3-4,6H,1-2H2,(H,11,12);1H
InChI key:InChIKey=KXXXTHCJQUBZNU-UHFFFAOYSA-N
SMILES:N(C1=C(F)C=C(Cl)C=N1)C2CC2.Cl
Synonyms:
  • 2-Pyridinamine, 5-chloro-N-cyclopropyl-3-fluoro-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.