
CAS 1073372-10-7
:2-Pyridinamine, 5-chloro-3-fluoro-N-(1-methylethyl)-, hydrochloride (1:1)
Description:
2-Pyridinamine, 5-chloro-3-fluoro-N-(1-methylethyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a chloro and a fluoro substituent at specific positions on the pyridine ring contributes to its reactivity and potential biological activity. The N-(1-methylethyl) group indicates that the compound has an isopropyl substituent, which can influence its solubility and interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The compound may exhibit properties such as antimicrobial or anti-inflammatory activity, making it of interest in medicinal chemistry. Its specific characteristics, including melting point, solubility, and spectral data, would be determined through experimental methods and are essential for understanding its behavior in various chemical environments.
Formula:C8H10ClFN2·ClH
InChI:InChI=1S/C8H10ClFN2.ClH/c1-5(2)12-8-7(10)3-6(9)4-11-8;/h3-5H,1-2H3,(H,11,12);1H
InChI key:InChIKey=XAVUHMPTJMMNGC-UHFFFAOYSA-N
SMILES:N(C(C)C)C1=C(F)C=C(Cl)C=N1.Cl
Synonyms:- 2-Pyridinamine, 5-chloro-3-fluoro-N-(1-methylethyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
