CAS 1073372-18-5
:5-Fluoro-N-[(5-fluoro-3-pyridinyl)methyl]-3-pyridinemethanamine
Description:
5-Fluoro-N-[(5-fluoro-3-pyridinyl)methyl]-3-pyridinemethanamine, with CAS number 1073372-18-5, is a chemical compound characterized by its complex structure, which includes multiple fluorine and pyridine moieties. This substance features a pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen, contributing to its potential biological activity. The presence of fluorine atoms enhances lipophilicity and can influence the compound's pharmacokinetic properties, making it of interest in medicinal chemistry. The amine functional group suggests potential for hydrogen bonding, which may play a role in its interactions with biological targets. This compound may exhibit properties relevant to drug development, particularly in the context of targeting specific receptors or enzymes. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be important factors to consider in both laboratory and therapeutic applications. Overall, this compound represents a class of molecules that could have significant implications in pharmaceutical research.
Formula:C12H11F2N3
InChI:InChI=1S/C12H11F2N3/c13-11-1-9(5-16-7-11)3-15-4-10-2-12(14)8-17-6-10/h1-2,5-8,15H,3-4H2
InChI key:InChIKey=KTHGMOBXEVLFKU-UHFFFAOYSA-N
SMILES:C(NCC=1C=C(F)C=NC1)C=2C=C(F)C=NC2
Synonyms:- 5-Fluoro-N-[(5-fluoro-3-pyridinyl)methyl]-3-pyridinemethanamine
- 3-Pyridinemethanamine, 5-fluoro-N-[(5-fluoro-3-pyridinyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
