CAS 1073468-34-4

Borate(1-), trifluoro[3-(4-nitrophenoxy)phenyl]-, potassium (1:1), (T-4)-

Description:

Borate(1-), trifluoro[3-(4-nitrophenoxy)phenyl]-, potassium (1:1), commonly referred to by its CAS number 1073468-34-4, is a chemical compound characterized by its borate anion structure, which includes a trifluoromethyl group and a nitrophenoxy substituent. This compound typically exhibits properties associated with both boron and organic functional groups, such as potential solubility in polar solvents and reactivity due to the presence of the nitro group, which can influence its electronic properties. The trifluoromethyl group contributes to its lipophilicity and may enhance its biological activity or stability. As a potassium salt, it is likely to be ionic in nature, which can affect its solubility and interaction with other substances. The presence of the nitrophenoxy moiety suggests potential applications in fields such as materials science or pharmaceuticals, where such compounds may serve as intermediates or functional materials. Overall, this compound's unique structure imparts a range of chemical behaviors that can be explored in various applications.

Formula: C₁₂H₈BF₃NO₃·K

InChI: InChI=1S/C12H8BF3NO3.K/c14-13(15,16)9-2-1-3-12(8-9)20-11-6-4-10(5-7-11)17(18)19;/h1-8H;/q-1;+1

InChI key: InChIKey=MDDGSLMMHZMFBQ-UHFFFAOYSA-N

SMILES: O(C=1C=[C-]([B+3]([F-])([F-])[F-])C=CC1)C2=CC=C(N(=O)=O)C=C2.[K+]

Synonyms:

• Borate(1-), trifluoro[3-(4-nitrophenoxy)phenyl]-, potassium (1:1), (T-4)-