CymitQuimica logo

CAS 107347-90-0

:

5-[[(Dimethylamino)iminomethyl]amino]-2-oxopentanoic acid

Description:
5-[[(Dimethylamino)iminomethyl]amino]-2-oxopentanoic acid, with the CAS number 107347-90-0, is a chemical compound that features a complex structure characterized by the presence of both amino and carboxylic acid functional groups. This compound is classified as an amino acid derivative, which suggests it may play a role in biological systems or serve as a precursor in synthetic pathways. The dimethylamino group indicates a tertiary amine, which can influence the compound's solubility and reactivity. The presence of the oxo group (carbonyl) contributes to its potential as a reactive intermediate in various chemical reactions. Additionally, the compound's structure suggests it may exhibit properties such as chelation or coordination with metal ions, which can be relevant in biochemical applications. Overall, its unique functional groups and structural features make it a compound of interest in both organic synthesis and potential pharmaceutical applications.
Formula:C8H15N3O3
InChI:InChI=1S/C8H15N3O3/c1-11(2)8(9)10-5-3-4-6(12)7(13)14/h3-5H2,1-2H3,(H2,9,10)(H,13,14)
InChI key:InChIKey=GLWRPXRMUUZNMD-UHFFFAOYSA-N
SMILES:C(CCCNC(N(C)C)=N)(C(O)=O)=O
Synonyms:
  • 5-[[(Dimethylamino)iminomethyl]amino]-2-oxopentanoic acid
  • Pentanoic acid, 5-[[(dimethylamino)iminomethyl]amino]-2-oxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.