CAS 1073493-76-1

Ethyl 3-[3-(1-naphthalenyloxy)propyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate

Description:

Ethyl 3-[3-(1-naphthalenyloxy)propyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate is a complex organic compound characterized by its indole core, which is a bicyclic structure containing a benzene ring fused to a pyrrole. This compound features a carboxylate ester functional group, contributing to its potential reactivity and solubility properties. The presence of a naphthalenyloxy group suggests potential applications in organic synthesis or as a ligand in coordination chemistry. Additionally, the inclusion of a boron-containing moiety, specifically a dioxaborolane, indicates potential utility in boron chemistry, possibly for applications in drug delivery or as a building block in organic synthesis. The compound's structure implies it may exhibit interesting biological activity, making it a candidate for further pharmacological studies. Overall, its unique combination of functional groups and structural features positions it as a versatile compound in both synthetic and medicinal chemistry contexts.

Formula: C₃₀H₃₄BNO₅

InChI: InChI=1S/C30H34BNO5/c1-6-34-28(33)27-23(16-11-19-35-25-18-9-13-20-12-7-8-14-21(20)25)22-15-10-17-24(26(22)32-27)31-36-29(2,3)30(4,5)37-31/h7-10,12-15,17-18,32H,6,11,16,19H2,1-5H3

InChI key: InChIKey=MMJMENWIYROGLC-UHFFFAOYSA-N

SMILES: C(CCOC=1C2=C(C=CC1)C=CC=C2)C=3C=4C(=C(C=CC4)B5OC(C)(C)C(C)(C)O5)NC3C(OCC)=O

Synonyms:

• 1H-Indole-2-carboxylic acid, 3-[3-(1-naphthalenyloxy)propyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-, ethyl ester
• Ethyl 3-[3-(1-naphthalenyloxy)propyl]-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-2-carboxylate