
CAS 107351-83-7
:N-Methyl-5-phenyl-2-pyridinamine
Description:
N-Methyl-5-phenyl-2-pyridinamine, with the CAS number 107351-83-7, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group attached to the nitrogen atom of the pyridine, as well as a phenyl group at the 5-position of the ring. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including medicinal chemistry. N-Methyl-5-phenyl-2-pyridinamine may exhibit properties such as solubility in organic solvents, and its nitrogen atom can participate in hydrogen bonding, influencing its interactions with biological targets. The compound's structure suggests potential for use in the development of pharmaceuticals, particularly in the context of targeting specific receptors or enzymes. As with many organic compounds, its stability, reactivity, and biological activity would depend on the specific conditions under which it is studied, including pH, temperature, and the presence of other chemical species.
Formula:C12H12N2
InChI:InChI=1S/C12H12N2/c1-13-12-8-7-11(9-14-12)10-5-3-2-4-6-10/h2-9H,1H3,(H,13,14)
InChI key:InChIKey=UJEVQEHGLVOPMN-UHFFFAOYSA-N
SMILES:N(C)C=1C=CC(=CN1)C2=CC=CC=C2
Synonyms:- N-Methyl-5-phenyl-2-pyridinamine
- 2-(Methylamino)-5-phenylpyridine
- 2-Pyridinamine, N-methyl-5-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.