
CAS 1073525-72-0
:3-Bromo-4-methoxy-6-(trifluoromethyl)pyridazine
Description:
3-Bromo-4-methoxy-6-(trifluoromethyl)pyridazine is a heterocyclic organic compound characterized by its pyridazine ring, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a bromine atom at the 3-position, a methoxy group (-OCH3) at the 4-position, and a trifluoromethyl group (-CF3) at the 6-position contributes to its unique chemical properties. This compound is likely to exhibit significant polarity due to the electronegative trifluoromethyl group, which can influence its reactivity and solubility in various solvents. The methoxy group can also participate in hydrogen bonding, affecting its interaction with other molecules. Additionally, the bromine substituent may provide sites for further chemical reactions, such as nucleophilic substitutions. Overall, the combination of these functional groups suggests that 3-Bromo-4-methoxy-6-(trifluoromethyl)pyridazine could be of interest in medicinal chemistry and material science, potentially serving as a precursor for the synthesis of more complex compounds or as a bioactive agent.
Formula:C6H4BrF3N2O
InChI:InChI=1S/C6H4BrF3N2O/c1-13-3-2-4(6(8,9)10)11-12-5(3)7/h2H,1H3
InChI key:InChIKey=JGWBKZNNGYJBNW-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(OC)=C(Br)N=N1
Synonyms:- 3-Bromo-4-methoxy-6-(trifluoromethyl)pyridazine
- Pyridazine, 3-bromo-4-methoxy-6-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.