CAS 1073608-19-1
:5-(4-Chlorobutyl)-1-cyclohexyltetrazole-d11
Description:
5-(4-Chlorobutyl)-1-cyclohexyltetrazole-d11 is a chemical compound characterized by its tetrazole ring, which is a five-membered heterocyclic structure containing four nitrogen atoms and one carbon atom. The presence of a cyclohexyl group and a 4-chlorobutyl substituent contributes to its unique properties, including potential lipophilicity and reactivity. The "d11" designation indicates that the compound is a deuterated form, meaning that certain hydrogen atoms have been replaced with deuterium, which can enhance its stability and alter its spectroscopic properties. This compound may be of interest in various fields, including medicinal chemistry and pharmacology, due to its potential biological activity. Its specific applications and behavior would depend on the interactions of its functional groups and the overall molecular structure. As with any chemical substance, safety data and handling precautions should be considered, particularly due to the presence of chlorine, which can impart toxicity.
Formula:C11H19ClN4
InChI:InChI=1S/C11H19ClN4/c12-9-5-4-8-11-13-14-15-16(11)10-6-2-1-3-7-10/h10H,1-9H2/i1D2,2D2,3D2,6D2,7D2,10D
InChI key:InChIKey=INTQSGGUSUSCTJ-BMWRUFNQSA-N
SMILES:C(CCCCl)C=1N(N=NN1)C2(C(C(C(C(C2([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])([2H])[2H])[2H]
Synonyms:- 5-(4-Chloro-butyl)-1-cyclohexyl-1H-tetrazole-d11
- 5-(4-Chlorobutyl)-1-cyclohexyltetrazole-d11
- 5-(4-Chlorobutyl)-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)tetrazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(4-Chlorobutyl)-1-cyclohexyltetrazole-d11
CAS:Controlled ProductApplications 5-(4-Chlorobutyl)-1-cyclohexyltetrazole-d11 (cas# 1073608-19-1) is a compound useful in organic synthesis.
Formula:C11H8D11ClN4Color and Shape:NeatMolecular weight:253.82
